C14H19N5 — CID 97165472
3-[(3S)-3-(aminomethyl)piperidin-1-yl]quinoxalin-2-amine (PubChem CID 97165472) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-[(3S)-3-(aminomethyl)piperidin-1-yl]quinoxalin-2-amine.
| Compound Name | 3-[(3S)-3-(aminomethyl)piperidin-1-yl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 97165472 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 3-[(3S)-3-(aminomethyl)piperidin-1-yl]quinoxalin-2-amine |
| SMILES | NC[C@@H]1CCCN(c2nc3ccccc3nc2N)C1 |
| InChI | InChI=1S/C14H19N5/c15-8-10-4-3-7-19(9-10)14-13(16)17-11-5-1-2-6-12(11)18-14/h1-2,5-6,10H,3-4,7-9,15H2,(H2,16,17)/t10-/m0/s1 |
| InChIKey | YCFIDRFTHDKXBU-JTQLQIEISA-N |
| XLogP | 1.39 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |