C14H16N2O2S — CID 71858345
4-(4-methylquinolin-2-yl)-1,4-thiazinane 1,1-dioxide (PubChem CID 71858345) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-(4-methylquinolin-2-yl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(4-methylquinolin-2-yl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 71858345 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-(4-methylquinolin-2-yl)-1,4-thiazinane 1,1-dioxide |
| SMILES | Cc1cc(N2CCS(=O)(=O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C14H16N2O2S/c1-11-10-14(15-13-5-3-2-4-12(11)13)16-6-8-19(17,18)9-7-16/h2-5,10H,6-9H2,1H3 |
| InChIKey | WHGPLADAQSIASP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |