About 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide
2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide (PubChem CID 107279407) has the molecular formula C13H18BrN3O
and a molecular weight of 312.21 g/mol. Its IUPAC name is 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide.
Molecular Properties
| Compound Name | 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide |
| PubChem CID | 107279407 |
| Molecular Formula | C13H18BrN3O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2C[C@@H](C)O[C@@H](C)C2)cc1Br |
| InChI | InChI=1S/C13H18BrN3O/c1-8-6-17(7-9(2)18-8)10-3-4-11(13(15)16)12(14)5-10/h3-5,8-9H,6-7H2,1-2H3,(H3,15,16)/t8-,9+ |
| InChIKey | IILNRYAFYXPCNX-DTORHVGOSA-N |
| XLogP | 2.35 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide?
The IUPAC name of 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide (CID 107279407) is 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide.
What is the SMILES notation for 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide?
The canonical SMILES for 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide is [H]/N=C(\N)c1ccc(N2C[C@@H](C)O[C@@H](C)C2)cc1Br.
What is the InChIKey of 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide?
The InChIKey is IILNRYAFYXPCNX-DTORHVGOSA-N. The full InChI is InChI=1S/C13H18BrN3O/c1-8-6-17(7-9(2)18-8)10-3-4-11(13(15)16)12(14)5-10/h3-5,8-9H,6-7H2,1-2H3,(H3,15,16)/t8-,9+.
What are the key properties of 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide?
2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide has a molecular weight of 312.21 g/mol, XLogP of 2.35, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]benzenecarboximidamide is sourced from PubChem (CID 107279407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).