C14H18BrNO2 — CID 114068730
1-[2-bromo-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethanone (PubChem CID 114068730) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is 1-[2-bromo-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethanone.
| Compound Name | 1-[2-bromo-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 114068730 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 1-[2-bromo-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2C[C@@H](C)O[C@@H](C)C2)cc1Br |
| InChI | InChI=1S/C14H18BrNO2/c1-9-7-16(8-10(2)18-9)12-4-5-13(11(3)17)14(15)6-12/h4-6,9-10H,7-8H2,1-3H3/t9-,10+ |
| InChIKey | NXLAPRQGVFUMRS-AOOOYVTPSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |