C18H22N2O3 — CID 133410698
ethyl 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-6-methylquinoline-3-carboxylate (PubChem CID 133410698) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is ethyl 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-6-methylquinoline-3-carboxylate.
| Compound Name | ethyl 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-6-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 133410698 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | ethyl 4-(3-hydroxy-3-methylpyrrolidin-1-yl)-6-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C)cc2c1N1CCC(C)(O)C1 |
| InChI | InChI=1S/C18H22N2O3/c1-4-23-17(21)14-10-19-15-6-5-12(2)9-13(15)16(14)20-8-7-18(3,22)11-20/h5-6,9-10,22H,4,7-8,11H2,1-3H3 |
| InChIKey | DQUMMKVCHGEJOE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |