C20H27N3O3 — CID 133388687
ethyl 4-(4-ethyl-1,4-diazepan-1-yl)-6-methoxyquinoline-3-carboxylate (PubChem CID 133388687) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl 4-(4-ethyl-1,4-diazepan-1-yl)-6-methoxyquinoline-3-carboxylate.
| Compound Name | ethyl 4-(4-ethyl-1,4-diazepan-1-yl)-6-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 133388687 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | ethyl 4-(4-ethyl-1,4-diazepan-1-yl)-6-methoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(OC)cc2c1N1CCCN(CC)CC1 |
| InChI | InChI=1S/C20H27N3O3/c1-4-22-9-6-10-23(12-11-22)19-16-13-15(25-3)7-8-18(16)21-14-17(19)20(24)26-5-2/h7-8,13-14H,4-6,9-12H2,1-3H3 |
| InChIKey | FNNIYWXJNPYFLU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |