C17H21N3O3 — CID 50877331
ethyl 7-methoxy-4-piperazin-1-ylquinoline-3-carboxylate (PubChem CID 50877331) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl 7-methoxy-4-piperazin-1-ylquinoline-3-carboxylate.
| Compound Name | ethyl 7-methoxy-4-piperazin-1-ylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 50877331 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | ethyl 7-methoxy-4-piperazin-1-ylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OC)ccc2c1N1CCNCC1 |
| InChI | InChI=1S/C17H21N3O3/c1-3-23-17(21)14-11-19-15-10-12(22-2)4-5-13(15)16(14)20-8-6-18-7-9-20/h4-5,10-11,18H,3,6-9H2,1-2H3 |
| InChIKey | GCTOOBAQRJRBGL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |