C24H27N3O3 — CID 162647102
ethyl 8-methoxy-4-[4-(2-methylphenyl)piperazin-1-yl]quinoline-3-carboxylate (PubChem CID 162647102) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is ethyl 8-methoxy-4-[4-(2-methylphenyl)piperazin-1-yl]quinoline-3-carboxylate.
| Compound Name | ethyl 8-methoxy-4-[4-(2-methylphenyl)piperazin-1-yl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 162647102 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | ethyl 8-methoxy-4-[4-(2-methylphenyl)piperazin-1-yl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(OC)cccc2c1N1CCN(c2ccccc2C)CC1 |
| InChI | InChI=1S/C24H27N3O3/c1-4-30-24(28)19-16-25-22-18(9-7-11-21(22)29-3)23(19)27-14-12-26(13-15-27)20-10-6-5-8-17(20)2/h5-11,16H,4,12-15H2,1-3H3 |
| InChIKey | PFULRXSHHBVYJO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |