C23H24Cl2N3O2+ — CID 4616474
ethyl 4-(4-benzylpiperazin-4-ium-1-yl)-6,8-dichloroquinoline-3-carboxylate (PubChem CID 4616474) has the molecular formula C23H24Cl2N3O2+ and a molecular weight of 445.37 g/mol. Its IUPAC name is ethyl 4-(4-benzylpiperazin-4-ium-1-yl)-6,8-dichloroquinoline-3-carboxylate.
| Compound Name | ethyl 4-(4-benzylpiperazin-4-ium-1-yl)-6,8-dichloroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 4616474 |
| Molecular Formula | C23H24Cl2N3O2+ |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | ethyl 4-(4-benzylpiperazin-4-ium-1-yl)-6,8-dichloroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(Cl)cc(Cl)cc2c1N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H23Cl2N3O2/c1-2-30-23(29)19-14-26-21-18(12-17(24)13-20(21)25)22(19)28-10-8-27(9-11-28)15-16-6-4-3-5-7-16/h3-7,12-14H,2,8-11,15H2,1H3/p+1 |
| InChIKey | BULAUUHBAXIPTO-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |