C7H9N5O — CID 122358737
[(E)-(2-amino-3-pyridinyl)methylideneamino]urea (PubChem CID 122358737) has the molecular formula C7H9N5O and a molecular weight of 179.18 g/mol. Its IUPAC name is [(E)-(2-amino-3-pyridinyl)methylideneamino]urea.
| Compound Name | [(E)-(2-amino-3-pyridinyl)methylideneamino]urea |
|---|---|
| PubChem CID | 122358737 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | [(E)-(2-amino-3-pyridinyl)methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1cccnc1N |
| InChI | InChI=1S/C7H9N5O/c8-6-5(2-1-3-10-6)4-11-12-7(9)13/h1-4H,(H2,8,10)(H3,9,12,13)/b11-4+ |
| InChIKey | PQOYDLUTVNIFJD-NYYWCZLTSA-N |
| XLogP | -0.33 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|