C24H29N3O2 — CID 2329565
N-[(4-octoxyphenyl)methylideneamino]-1H-indole-3-carboxamide (PubChem CID 2329565) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[(4-octoxyphenyl)methylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[(4-octoxyphenyl)methylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 2329565 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[(4-octoxyphenyl)methylideneamino]-1H-indole-3-carboxamide |
| SMILES | CCCCCCCCOc1ccc(C=NNC(=O)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H29N3O2/c1-2-3-4-5-6-9-16-29-20-14-12-19(13-15-20)17-26-27-24(28)22-18-25-23-11-8-7-10-21(22)23/h7-8,10-15,17-18,25H,2-6,9,16H2,1H3,(H,27,28) |
| InChIKey | LFPRVHLEMROEBI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|