C20H15Cl2N5O — CID 135411501
1-[(2,4-dichlorophenyl)methyl]-N-[(E)-1H-indol-3-ylmethylideneamino]pyrazole-3-carboxamide (PubChem CID 135411501) has the molecular formula C20H15Cl2N5O and a molecular weight of 412.28 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-N-[(E)-1H-indol-3-ylmethylideneamino]pyrazole-3-carboxamide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-N-[(E)-1H-indol-3-ylmethylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135411501 |
| Molecular Formula | C20H15Cl2N5O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-N-[(E)-1H-indol-3-ylmethylideneamino]pyrazole-3-carboxamide |
| SMILES | O=C(N/N=C/c1c[nH]c2ccccc12)c1ccn(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C20H15Cl2N5O/c21-15-6-5-13(17(22)9-15)12-27-8-7-19(26-27)20(28)25-24-11-14-10-23-18-4-2-1-3-16(14)18/h1-11,23H,12H2,(H,25,28)/b24-11+ |
| InChIKey | CJCNDUFXXRRGDZ-BHGWPJFGSA-N |
| XLogP | 4.48 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|