C16H11Cl2N5O3S — CID 19577381
1-[(2,4-dichlorophenyl)methyl]-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 19577381) has the molecular formula C16H11Cl2N5O3S and a molecular weight of 424.27 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19577381 |
| Molecular Formula | C16H11Cl2N5O3S |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | O=C(N/N=C/c1ccc([N+](=O)[O-])s1)c1ccn(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C16H11Cl2N5O3S/c17-11-2-1-10(13(18)7-11)9-22-6-5-14(21-22)16(24)20-19-8-12-3-4-15(27-12)23(25)26/h1-8H,9H2,(H,20,24)/b19-8+ |
| InChIKey | QSJSOBGKQNPUQO-UFWORHAWSA-N |
| XLogP | 3.97 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|