C20H19BrN4O2 — CID 1273570
1-[(4-bromophenyl)methyl]-N-[(4-ethoxyphenyl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 1273570) has the molecular formula C20H19BrN4O2 and a molecular weight of 427.30 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[(4-ethoxyphenyl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[(4-ethoxyphenyl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1273570 |
| Molecular Formula | C20H19BrN4O2 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[(4-ethoxyphenyl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | CCOc1ccc(C=NNC(=O)c2ccn(Cc3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C20H19BrN4O2/c1-2-27-18-9-5-15(6-10-18)13-22-23-20(26)19-11-12-25(24-19)14-16-3-7-17(21)8-4-16/h3-13H,2,14H2,1H3,(H,23,26) |
| InChIKey | GWKVNNRKDUHYBT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|