C18H14BrFN4O — CID 1273633
1-[(4-bromophenyl)methyl]-N-[(4-fluorophenyl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 1273633) has the molecular formula C18H14BrFN4O and a molecular weight of 401.24 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[(4-fluorophenyl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[(4-fluorophenyl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1273633 |
| Molecular Formula | C18H14BrFN4O |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[(4-fluorophenyl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | O=C(NN=Cc1ccc(F)cc1)c1ccn(Cc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C18H14BrFN4O/c19-15-5-1-14(2-6-15)12-24-10-9-17(23-24)18(25)22-21-11-13-3-7-16(20)8-4-13/h1-11H,12H2,(H,22,25) |
| InChIKey | ZWHDIJZFFXDBEH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|