C51H48N2O4S2 — CID 91326738
benzyl 2-[8-(ethenylamino)-5-[2-[(4-ethenylphenyl)methyl]phenyl]sulfanyl-4-(methylamino)-9,10-dioxoanthracen-1-yl]sulfanylbenzoate;ethane;prop-1-ene (PubChem CID 91326738) has the molecular formula C51H48N2O4S2 and a molecular weight of 817.09 g/mol. Its IUPAC name is benzyl 2-[8-(ethenylamino)-5-[2-[(4-ethenylphenyl)methyl]phenyl]sulfanyl-4-(methylamino)-9,10-dioxoanthracen-1-yl]sulfanylbenzoate;ethane;prop-1-ene.
| Compound Name | benzyl 2-[8-(ethenylamino)-5-[2-[(4-ethenylphenyl)methyl]phenyl]sulfanyl-4-(methylamino)-9,10-dioxoanthracen-1-yl]sulfanylbenzoate;ethane;prop-1-ene |
|---|---|
| PubChem CID | 91326738 |
| Molecular Formula | C51H48N2O4S2 |
| Molecular Weight | 817.09 g/mol |
| Exact Mass | 816.31 |
| IUPAC Name | benzyl 2-[8-(ethenylamino)-5-[2-[(4-ethenylphenyl)methyl]phenyl]sulfanyl-4-(methylamino)-9,10-dioxoanthracen-1-yl]sulfanylbenzoate;ethane;prop-1-ene |
| SMILES | C=CC.C=CNc1ccc(Sc2ccccc2Cc2ccc(C=C)cc2)c2c1C(=O)c1c(Sc3ccccc3C(=O)OCc3ccccc3)ccc(NC)c1C2=O.CC |
| InChI | InChI=1S/C46H36N2O4S2.C3H6.C2H6/c1-4-29-19-21-30(22-20-29)27-32-15-9-11-17-36(32)53-38-26-24-35(48-5-2)41-43(38)44(49)40-34(47-3)23-25-39(42(40)45(41)50)54-37-18-12-10-16-33(37)46(51)52-28-31-13-7-6-8-14-31;1-3-2;1-2/h4-26,47-48H,1-2,27-28H2,3H3;3H,1H2,2H3;1-2H3 |
| InChIKey | JTBKOCALQMSBJI-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.09 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|