About benzyl 2-cyano-5-fluorobenzoate
benzyl 2-cyano-5-fluorobenzoate (PubChem CID 172648964) has the molecular formula C15H10FNO2
and a molecular weight of 255.25 g/mol. Its IUPAC name is benzyl 2-cyano-5-fluorobenzoate.
Molecular Properties
| Compound Name | benzyl 2-cyano-5-fluorobenzoate |
| PubChem CID | 172648964 |
| Molecular Formula | C15H10FNO2 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | benzyl 2-cyano-5-fluorobenzoate |
| SMILES | N#Cc1ccc(F)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H10FNO2/c16-13-7-6-12(9-17)14(8-13)15(18)19-10-11-4-2-1-3-5-11/h1-8H,10H2 |
| InChIKey | AOHHPAFGUAXLNJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-cyano-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-cyano-5-fluorobenzoate?
The IUPAC name of benzyl 2-cyano-5-fluorobenzoate (CID 172648964) is benzyl 2-cyano-5-fluorobenzoate.
What is the SMILES notation for benzyl 2-cyano-5-fluorobenzoate?
The canonical SMILES for benzyl 2-cyano-5-fluorobenzoate is N#Cc1ccc(F)cc1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-cyano-5-fluorobenzoate?
The InChIKey is AOHHPAFGUAXLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FNO2/c16-13-7-6-12(9-17)14(8-13)15(18)19-10-11-4-2-1-3-5-11/h1-8H,10H2.
What are the key properties of benzyl 2-cyano-5-fluorobenzoate?
benzyl 2-cyano-5-fluorobenzoate has a molecular weight of 255.25 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-cyano-5-fluorobenzoate is sourced from PubChem (CID 172648964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).