C27H27NO6S — CID 32971847
[4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 32971847) has the molecular formula C27H27NO6S and a molecular weight of 493.58 g/mol. Its IUPAC name is [4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 32971847 |
| Molecular Formula | C27H27NO6S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccccc2C(=O)OCc2ccc(C(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C27H27NO6S/c1-19-9-10-20(2)25(17-19)35(31,32)34-24-8-4-3-7-23(24)27(30)33-18-21-11-13-22(14-12-21)26(29)28-15-5-6-16-28/h3-4,7-14,17H,5-6,15-16,18H2,1-2H3 |
| InChIKey | FXHPCAYFWATVAQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|