C16H15BrN2O4S — CID 9080472
[2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 9080472) has the molecular formula C16H15BrN2O4S and a molecular weight of 411.28 g/mol. Its IUPAC name is [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 9080472 |
| Molecular Formula | C16H15BrN2O4S |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | O=C(COC(=O)Cc1ccsc1)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C16H15BrN2O4S/c17-12-3-1-2-4-13(12)19-14(20)8-18-15(21)9-23-16(22)7-11-5-6-24-10-11/h1-6,10H,7-9H2,(H,18,21)(H,19,20) |
| InChIKey | PZPYXMDIELENFV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |