C12H15NO5S — CID 8654437
[2-(ethoxycarbonylamino)-2-oxoethyl] 3-thiophen-3-ylpropanoate (PubChem CID 8654437) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 3-thiophen-3-ylpropanoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 8654437 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 3-thiophen-3-ylpropanoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)CCc1ccsc1 |
| InChI | InChI=1S/C12H15NO5S/c1-2-17-12(16)13-10(14)7-18-11(15)4-3-9-5-6-19-8-9/h5-6,8H,2-4,7H2,1H3,(H,13,14,16) |
| InChIKey | XPVUOOLWVAVNLF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |