C13H16N2O4S — CID 30060919
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-thiophen-3-ylpropanoate (PubChem CID 30060919) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-thiophen-3-ylpropanoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 30060919 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-thiophen-3-ylpropanoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)CCc1ccsc1 |
| InChI | InChI=1S/C13H16N2O4S/c1-2-6-14-13(18)15-11(16)8-19-12(17)4-3-10-5-7-20-9-10/h2,5,7,9H,1,3-4,6,8H2,(H2,14,15,16,18) |
| InChIKey | XSRUPILFGPCXOG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|