C15H12F3NO3S — CID 2344902
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-thiophen-3-ylacetate (PubChem CID 2344902) has the molecular formula C15H12F3NO3S and a molecular weight of 343.33 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 2344902 |
| Molecular Formula | C15H12F3NO3S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-thiophen-3-ylacetate |
| SMILES | O=C(COC(=O)Cc1ccsc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F3NO3S/c16-15(17,18)11-1-3-12(4-2-11)19-13(20)8-22-14(21)7-10-5-6-23-9-10/h1-6,9H,7-8H2,(H,19,20) |
| InChIKey | MYTVLFPQRRUEEQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |