C17H19NO4S — CID 9323185
[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 9323185) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 9323185 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | COc1ccc(CCNC(=O)COC(=O)Cc2ccsc2)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-21-15-4-2-13(3-5-15)6-8-18-16(19)11-22-17(20)10-14-7-9-23-12-14/h2-5,7,9,12H,6,8,10-11H2,1H3,(H,18,19) |
| InChIKey | IBALPHFXXXNFRT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |