C12H5F5O2S — CID 10470503
(2,3,4,5,6-pentafluorophenyl) 2-thiophen-3-ylacetate (PubChem CID 10470503) has the molecular formula C12H5F5O2S and a molecular weight of 308.23 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-thiophen-3-ylacetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 10470503 |
| Molecular Formula | C12H5F5O2S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-thiophen-3-ylacetate |
| SMILES | O=C(Cc1ccsc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H5F5O2S/c13-7-8(14)10(16)12(11(17)9(7)15)19-6(18)3-5-1-2-20-4-5/h1-2,4H,3H2 |
| InChIKey | QBQSGGVPCORTAZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|