C7H6F2OS — CID 61055642
1,1-difluoro-3-thiophen-3-ylpropan-2-one (PubChem CID 61055642) has the molecular formula C7H6F2OS and a molecular weight of 176.19 g/mol. Its IUPAC name is 1,1-difluoro-3-thiophen-3-ylpropan-2-one.
| Compound Name | 1,1-difluoro-3-thiophen-3-ylpropan-2-one |
|---|---|
| PubChem CID | 61055642 |
| Molecular Formula | C7H6F2OS |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | 1,1-difluoro-3-thiophen-3-ylpropan-2-one |
| SMILES | O=C(Cc1ccsc1)C(F)F |
| InChI | InChI=1S/C7H6F2OS/c8-7(9)6(10)3-5-1-2-11-4-5/h1-2,4,7H,3H2 |
| InChIKey | UDLRJXDTVBLWRD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |