C24H25F5O2 — CID 138457468
(2,3,4,5,6-pentafluorophenyl) 2-[4-(cyclononylmethyl)phenyl]acetate (PubChem CID 138457468) has the molecular formula C24H25F5O2 and a molecular weight of 440.45 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[4-(cyclononylmethyl)phenyl]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[4-(cyclononylmethyl)phenyl]acetate |
|---|---|
| PubChem CID | 138457468 |
| Molecular Formula | C24H25F5O2 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[4-(cyclononylmethyl)phenyl]acetate |
| SMILES | O=C(Cc1ccc(CC2CCCCCCCC2)cc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H25F5O2/c25-19-20(26)22(28)24(23(29)21(19)27)31-18(30)14-17-11-9-16(10-12-17)13-15-7-5-3-1-2-4-6-8-15/h9-12,15H,1-8,13-14H2 |
| InChIKey | WZZTZBRHDIALDG-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|