C15H14ClNO3S — CID 2591052
[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate (PubChem CID 2591052) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate.
| Compound Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 2591052 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate |
| SMILES | C[C@@H](OC(=O)Cc1ccsc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO3S/c1-10(20-14(18)8-11-6-7-21-9-11)15(19)17-13-4-2-12(16)3-5-13/h2-7,9-10H,8H2,1H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | FYVRDLCDFZSRRU-SNVBAGLBSA-N |
| XLogP | 3.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |