C12H14ClNO4 — CID 7776019
[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-methoxyacetate (PubChem CID 7776019) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-methoxyacetate.
| Compound Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 7776019 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@H](C)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClNO4/c1-8(18-11(15)7-17-2)12(16)14-10-5-3-9(13)4-6-10/h3-6,8H,7H2,1-2H3,(H,14,16)/t8-/m1/s1 |
| InChIKey | YJRKERLIHAYZAG-MRVPVSSYSA-N |
| XLogP | 1.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |