C18H16ClNO5 — CID 8609162
[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate (PubChem CID 8609162) has the molecular formula C18H16ClNO5 and a molecular weight of 361.78 g/mol. Its IUPAC name is [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate.
| Compound Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8609162 |
| Molecular Formula | C18H16ClNO5 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1ccccc1C=O)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClNO5/c1-12(18(23)20-15-8-6-14(19)7-9-15)25-17(22)11-24-16-5-3-2-4-13(16)10-21/h2-10,12H,11H2,1H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | KQYBUAXNSXZCDR-GFCCVEGCSA-N |
| XLogP | 3.10 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|