C21H23NO5 — CID 8608468
[(2S)-1-oxo-1-[[(2S)-2-phenylpropyl]amino]propan-2-yl] 2-(2-formylphenoxy)acetate (PubChem CID 8608468) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[[(2S)-2-phenylpropyl]amino]propan-2-yl] 2-(2-formylphenoxy)acetate.
| Compound Name | [(2S)-1-oxo-1-[[(2S)-2-phenylpropyl]amino]propan-2-yl] 2-(2-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8608468 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [(2S)-1-oxo-1-[[(2S)-2-phenylpropyl]amino]propan-2-yl] 2-(2-formylphenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccccc1C=O)C(=O)NC[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H23NO5/c1-15(17-8-4-3-5-9-17)12-22-21(25)16(2)27-20(24)14-26-19-11-7-6-10-18(19)13-23/h3-11,13,15-16H,12,14H2,1-2H3,(H,22,25)/t15-,16+/m1/s1 |
| InChIKey | HVKOALJKHIQXMX-CVEARBPZSA-N |
| XLogP | 2.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|