C19H25NO5 — CID 8609272
[(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate (PubChem CID 8609272) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is [(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate.
| Compound Name | [(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8609272 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [(2R)-1-[[(1S,2R)-2-methylcyclohexyl]amino]-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)[C@@H](C)OC(=O)COc1ccccc1C=O |
| InChI | InChI=1S/C19H25NO5/c1-13-7-3-5-9-16(13)20-19(23)14(2)25-18(22)12-24-17-10-6-4-8-15(17)11-21/h4,6,8,10-11,13-14,16H,3,5,7,9,12H2,1-2H3,(H,20,23)/t13-,14-,16+/m1/s1 |
| InChIKey | HEUYXHBNGDWHDO-FMKPAKJESA-N |
| XLogP | 2.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|