C12H13ClN2O4S — CID 2638016
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate (PubChem CID 2638016) has the molecular formula C12H13ClN2O4S and a molecular weight of 316.77 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 2638016 |
| Molecular Formula | C12H13ClN2O4S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-chloro-5-methylsulfanylbenzoate |
| SMILES | CSc1ccc(Cl)c(C(=O)O[C@@H](C)C(=O)NC(N)=O)c1 |
| InChI | InChI=1S/C12H13ClN2O4S/c1-6(10(16)15-12(14)18)19-11(17)8-5-7(20-2)3-4-9(8)13/h3-6H,1-2H3,(H3,14,15,16,18)/t6-/m0/s1 |
| InChIKey | CVKSTLQQFJSTQA-LURJTMIESA-N |
| XLogP | 1.80 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |