C15H17N3O4 — CID 8606926
[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 1H-indole-3-carboxylate (PubChem CID 8606926) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 1H-indole-3-carboxylate.
| Compound Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 8606926 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 1H-indole-3-carboxylate |
| SMILES | CC(C)[C@@H](OC(=O)c1c[nH]c2ccccc12)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H17N3O4/c1-8(2)12(13(19)18-15(16)21)22-14(20)10-7-17-11-6-4-3-5-9(10)11/h3-8,12,17H,1-2H3,(H3,16,18,19,21)/t12-/m1/s1 |
| InChIKey | BDUPSXYNNUCYQE-GFCCVEGCSA-N |
| XLogP | 1.54 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |