C15H20FN3O6S — CID 7976325
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 5-(dimethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7976325) has the molecular formula C15H20FN3O6S and a molecular weight of 389.41 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 5-(dimethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7976325 |
| Molecular Formula | C15H20FN3O6S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CC(C)[C@H](OC(=O)c1cc(S(=O)(=O)N(C)C)ccc1F)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H20FN3O6S/c1-8(2)12(13(20)18-15(17)22)25-14(21)10-7-9(5-6-11(10)16)26(23,24)19(3)4/h5-8,12H,1-4H3,(H3,17,18,20,22)/t12-/m0/s1 |
| InChIKey | PMRKWCOAOAETEB-LBPRGKRZSA-N |
| XLogP | 0.45 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |