C18H17ClFNO5S — CID 7976204
[(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 5-(dimethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7976204) has the molecular formula C18H17ClFNO5S and a molecular weight of 413.85 g/mol. Its IUPAC name is [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 5-(dimethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7976204 |
| Molecular Formula | C18H17ClFNO5S |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(S(=O)(=O)N(C)C)ccc1F)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClFNO5S/c1-11(17(22)12-4-6-13(19)7-5-12)26-18(23)15-10-14(8-9-16(15)20)27(24,25)21(2)3/h4-11H,1-3H3/t11-/m0/s1 |
| InChIKey | KKLYDJJGYPTLBN-NSHDSACASA-N |
| XLogP | 3.16 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |