C27H29N3O8S — CID 3522794
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoate (PubChem CID 3522794) has the molecular formula C27H29N3O8S and a molecular weight of 555.61 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 3522794 |
| Molecular Formula | C27H29N3O8S |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1ccccc1NS(=O)(=O)c1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C27H29N3O8S/c1-17-10-11-18(27(2,3)4)14-24(17)39(35,36)29-21-9-7-6-8-20(21)26(32)38-16-25(31)28-22-13-12-19(30(33)34)15-23(22)37-5/h6-15,29H,16H2,1-5H3,(H,28,31) |
| InChIKey | GGTIZUNNNCWDSM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|