C14H11N2O7S- — CID 54725190
2-carboxy-5-[(2-methyl-5-nitrophenyl)sulfonylamino]phenolate (PubChem CID 54725190) has the molecular formula C14H11N2O7S- and a molecular weight of 351.32 g/mol. Its IUPAC name is 2-carboxy-5-[(2-methyl-5-nitrophenyl)sulfonylamino]phenolate.
| Compound Name | 2-carboxy-5-[(2-methyl-5-nitrophenyl)sulfonylamino]phenolate |
|---|---|
| PubChem CID | 54725190 |
| Molecular Formula | C14H11N2O7S- |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-carboxy-5-[(2-methyl-5-nitrophenyl)sulfonylamino]phenolate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccc(C(=O)O)c([O-])c1 |
| InChI | InChI=1S/C14H12N2O7S/c1-8-2-4-10(16(20)21)7-13(8)24(22,23)15-9-3-5-11(14(18)19)12(17)6-9/h2-7,15,17H,1H3,(H,18,19)/p-1 |
| InChIKey | LUHWLQNRNKRCSN-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 149.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|