C17H18NO5S- — CID 54691364
2-carboxy-5-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenolate (PubChem CID 54691364) has the molecular formula C17H18NO5S- and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-carboxy-5-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenolate.
| Compound Name | 2-carboxy-5-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenolate |
|---|---|
| PubChem CID | 54691364 |
| Molecular Formula | C17H18NO5S- |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-carboxy-5-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenolate |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)Nc2ccc(C(=O)O)c([O-])c2)c1C |
| InChI | InChI=1S/C17H19NO5S/c1-9-7-10(2)12(4)16(11(9)3)24(22,23)18-13-5-6-14(17(20)21)15(19)8-13/h5-8,18-19H,1-4H3,(H,20,21)/p-1 |
| InChIKey | PSHPILRBLRCHCW-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |