C21H18ClN3O3S — CID 23740440
4-(3-chloro-2-cyanophenoxy)-N-methyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide (PubChem CID 23740440) has the molecular formula C21H18ClN3O3S and a molecular weight of 427.91 g/mol. Its IUPAC name is 4-(3-chloro-2-cyanophenoxy)-N-methyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide.
| Compound Name | 4-(3-chloro-2-cyanophenoxy)-N-methyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23740440 |
| Molecular Formula | C21H18ClN3O3S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 4-(3-chloro-2-cyanophenoxy)-N-methyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
| SMILES | CN(CCc1ccccn1)S(=O)(=O)c1ccc(Oc2cccc(Cl)c2C#N)cc1 |
| InChI | InChI=1S/C21H18ClN3O3S/c1-25(14-12-16-5-2-3-13-24-16)29(26,27)18-10-8-17(9-11-18)28-21-7-4-6-20(22)19(21)15-23/h2-11,13H,12,14H2,1H3 |
| InChIKey | RVHMRPLCUQRMKD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |