C21H17ClN2O3S — CID 3716205
4-(3-chloro-2-cyanophenoxy)-N-ethyl-N-phenylbenzenesulfonamide (PubChem CID 3716205) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is 4-(3-chloro-2-cyanophenoxy)-N-ethyl-N-phenylbenzenesulfonamide.
| Compound Name | 4-(3-chloro-2-cyanophenoxy)-N-ethyl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 3716205 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-(3-chloro-2-cyanophenoxy)-N-ethyl-N-phenylbenzenesulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(Oc2cccc(Cl)c2C#N)cc1 |
| InChI | InChI=1S/C21H17ClN2O3S/c1-2-24(16-7-4-3-5-8-16)28(25,26)18-13-11-17(12-14-18)27-21-10-6-9-20(22)19(21)15-23/h3-14H,2H2,1H3 |
| InChIKey | LBTKNTHVCYFNAB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |