C20H28N3O3S+ — CID 9113349
N-[(4-ethoxyphenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 9113349) has the molecular formula C20H28N3O3S+ and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9113349 |
| Molecular Formula | C20H28N3O3S+ |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | CCOc1ccc(CN(C)c2ccc(S(=O)(=O)N3CCCCC3)c[nH+]2)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-3-26-18-9-7-17(8-10-18)16-22(2)20-12-11-19(15-21-20)27(24,25)23-13-5-4-6-14-23/h7-12,15H,3-6,13-14,16H2,1-2H3/p+1 |
| InChIKey | WVLBAUZOLJAXTJ-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 63.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |