C18H23FN3O2S+ — CID 9194973
N-[(2-fluorophenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 9194973) has the molecular formula C18H23FN3O2S+ and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9194973 |
| Molecular Formula | C18H23FN3O2S+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-methyl-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | CN(Cc1ccccc1F)c1ccc(S(=O)(=O)N2CCCCC2)c[nH+]1 |
| InChI | InChI=1S/C18H22FN3O2S/c1-21(14-15-7-3-4-8-17(15)19)18-10-9-16(13-20-18)25(23,24)22-11-5-2-6-12-22/h3-4,7-10,13H,2,5-6,11-12,14H2,1H3/p+1 |
| InChIKey | IJKFROGYCDPTEC-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 54.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |