C18H24N3O3S+ — CID 9282043
N-[(4-methoxyphenyl)methyl]-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine (PubChem CID 9282043) has the molecular formula C18H24N3O3S+ and a molecular weight of 362.48 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9282043 |
| Molecular Formula | C18H24N3O3S+ |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-5-piperidin-1-ylsulfonylpyridin-1-ium-2-amine |
| SMILES | COc1ccc(CNc2ccc(S(=O)(=O)N3CCCCC3)c[nH+]2)cc1 |
| InChI | InChI=1S/C18H23N3O3S/c1-24-16-7-5-15(6-8-16)13-19-18-10-9-17(14-20-18)25(22,23)21-11-3-2-4-12-21/h5-10,14H,2-4,11-13H2,1H3,(H,19,20)/p+1 |
| InChIKey | ASHJSWKKFDCPJS-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |