C15H24ClNO4 — CID 119913696
2-[methyl-[2-(4-propoxyphenoxy)ethyl]amino]propanoic acid;hydrochloride (PubChem CID 119913696) has the molecular formula C15H24ClNO4 and a molecular weight of 317.81 g/mol. Its IUPAC name is 2-[methyl-[2-(4-propoxyphenoxy)ethyl]amino]propanoic acid;hydrochloride.
| Compound Name | 2-[methyl-[2-(4-propoxyphenoxy)ethyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913696 |
| Molecular Formula | C15H24ClNO4 |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-[methyl-[2-(4-propoxyphenoxy)ethyl]amino]propanoic acid;hydrochloride |
| SMILES | CCCOc1ccc(OCCN(C)C(C)C(=O)O)cc1.Cl |
| InChI | InChI=1S/C15H23NO4.ClH/c1-4-10-19-13-5-7-14(8-6-13)20-11-9-16(3)12(2)15(17)18;/h5-8,12H,4,9-11H2,1-3H3,(H,17,18);1H |
| InChIKey | AFOKFGZYSQZVKK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |