C13H16F3NO4 — CID 119913329
2-[methyl-[2-[4-(trifluoromethoxy)phenoxy]ethyl]amino]propanoic acid (PubChem CID 119913329) has the molecular formula C13H16F3NO4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-[methyl-[2-[4-(trifluoromethoxy)phenoxy]ethyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[2-[4-(trifluoromethoxy)phenoxy]ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119913329 |
| Molecular Formula | C13H16F3NO4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[methyl-[2-[4-(trifluoromethoxy)phenoxy]ethyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)CCOc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO4/c1-9(12(18)19)17(2)7-8-20-10-3-5-11(6-4-10)21-13(14,15)16/h3-6,9H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | ANQGVOCCMPNTJL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |