2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid

C12H15Cl2NO3 — CID 119912857

IUPAC2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid
SMILESCC(C(=O)O)N(C)CCOc1cc(Cl)cc(Cl)c1
InChIInChI=1S/C12H15Cl2NO3/c1-8(12(16)17)15(2)3-4-18-11-6-9(13)5-10(14)7-11/h5-8H,3-4H2,1-2H3,(H,16,17)
InChIKeyOABVZJIMQPBOJB-UHFFFAOYSA-N
MW292.16 g/mol
LogP2.78
Rot. Bonds6

About 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid

2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid (PubChem CID 119912857) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid.

Molecular Properties

Compound Name2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid
PubChem CID119912857
Molecular FormulaC12H15Cl2NO3
Molecular Weight292.16 g/mol
Exact Mass291.04
IUPAC Name2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid
SMILESCC(C(=O)O)N(C)CCOc1cc(Cl)cc(Cl)c1
InChIInChI=1S/C12H15Cl2NO3/c1-8(12(16)17)15(2)3-4-18-11-6-9(13)5-10(14)7-11/h5-8H,3-4H2,1-2H3,(H,16,17)
InChIKeyOABVZJIMQPBOJB-UHFFFAOYSA-N
XLogP2.78
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.16
LogP ≤ 52.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid?
The IUPAC name of 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid (CID 119912857) is 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid.
What is the SMILES notation for 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid?
The canonical SMILES for 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid is CC(C(=O)O)N(C)CCOc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid?
The InChIKey is OABVZJIMQPBOJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO3/c1-8(12(16)17)15(2)3-4-18-11-6-9(13)5-10(14)7-11/h5-8H,3-4H2,1-2H3,(H,16,17).
What are the key properties of 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid?
2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid has a molecular weight of 292.16 g/mol, XLogP of 2.78, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dichlorophenoxy)ethyl-methylamino]propanoic acid is sourced from PubChem (CID 119912857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).