C36H50Cl4N6O8 — CID 88691930
bis[2-(3,5-dichlorophenoxy)ethyl-[2-(dimethylamino)ethyl-propan-2-ylcarbamoyl]amino] (Z)-but-2-enedioate (PubChem CID 88691930) has the molecular formula C36H50Cl4N6O8 and a molecular weight of 836.64 g/mol. Its IUPAC name is bis[2-(3,5-dichlorophenoxy)ethyl-[2-(dimethylamino)ethyl-propan-2-ylcarbamoyl]amino] (Z)-but-2-enedioate.
| Compound Name | bis[2-(3,5-dichlorophenoxy)ethyl-[2-(dimethylamino)ethyl-propan-2-ylcarbamoyl]amino] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 88691930 |
| Molecular Formula | C36H50Cl4N6O8 |
| Molecular Weight | 836.64 g/mol |
| Exact Mass | 834.24 |
| IUPAC Name | bis[2-(3,5-dichlorophenoxy)ethyl-[2-(dimethylamino)ethyl-propan-2-ylcarbamoyl]amino] (Z)-but-2-enedioate |
| SMILES | CC(C)N(CCN(C)C)C(=O)N(CCOc1cc(Cl)cc(Cl)c1)OC(=O)/C=C\C(=O)ON(CCOc1cc(Cl)cc(Cl)c1)C(=O)N(CCN(C)C)C(C)C |
| InChI | InChI=1S/C36H50Cl4N6O8/c1-25(2)43(13-11-41(5)6)35(49)45(15-17-51-31-21-27(37)19-28(38)22-31)53-33(47)9-10-34(48)54-46(36(50)44(26(3)4)14-12-42(7)8)16-18-52-32-23-29(39)20-30(40)24-32/h9-10,19-26H,11-18H2,1-8H3/b10-9- |
| InChIKey | RXIOQJUUHWFCRG-KTKRTIGZSA-N |
| XLogP | 6.62 |
| TPSA | 124.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|