C20H29Cl2N3O6 — CID 88753142
(Z)-but-2-enedioic acid;1-(3,5-dichlorophenoxy)-1-[2-(dimethylamino)ethyl]-3-ethyl-3-propylurea (PubChem CID 88753142) has the molecular formula C20H29Cl2N3O6 and a molecular weight of 478.37 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(3,5-dichlorophenoxy)-1-[2-(dimethylamino)ethyl]-3-ethyl-3-propylurea.
| Compound Name | (Z)-but-2-enedioic acid;1-(3,5-dichlorophenoxy)-1-[2-(dimethylamino)ethyl]-3-ethyl-3-propylurea |
|---|---|
| PubChem CID | 88753142 |
| Molecular Formula | C20H29Cl2N3O6 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(3,5-dichlorophenoxy)-1-[2-(dimethylamino)ethyl]-3-ethyl-3-propylurea |
| SMILES | CCCN(CC)C(=O)N(CCN(C)C)Oc1cc(Cl)cc(Cl)c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H25Cl2N3O2.C4H4O4/c1-5-7-20(6-2)16(22)21(9-8-19(3)4)23-15-11-13(17)10-14(18)12-15;5-3(6)1-2-4(7)8/h10-12H,5-9H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | IDJZGXDDFDMCNN-BTJKTKAUSA-N |
| XLogP | 3.71 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|