C19H28N2O6 — CID 24832558
(E)-but-2-enedioic acid;N-[3-(dimethylamino)propyl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 24832558) has the molecular formula C19H28N2O6 and a molecular weight of 380.44 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[3-(dimethylamino)propyl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | (E)-but-2-enedioic acid;N-[3-(dimethylamino)propyl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24832558 |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[3-(dimethylamino)propyl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(N(CCCN(C)C)C(C)=O)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H24N2O2.C4H4O4/c1-5-19-15-9-7-14(8-10-15)17(13(2)18)12-6-11-16(3)4;5-3(6)1-2-4(7)8/h7-10H,5-6,11-12H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | AESKVQITOJJWSV-WLHGVMLRSA-N |
| XLogP | 2.10 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|