C20H28N2O — CID 24843292
N'-benzyl-N'-(4-ethoxyphenyl)-N,N-dimethylpropane-1,3-diamine (PubChem CID 24843292) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is N'-benzyl-N'-(4-ethoxyphenyl)-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-benzyl-N'-(4-ethoxyphenyl)-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 24843292 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N'-benzyl-N'-(4-ethoxyphenyl)-N,N-dimethylpropane-1,3-diamine |
| SMILES | CCOc1ccc(N(CCCN(C)C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H28N2O/c1-4-23-20-13-11-19(12-14-20)22(16-8-15-21(2)3)17-18-9-6-5-7-10-18/h5-7,9-14H,4,8,15-17H2,1-3H3 |
| InChIKey | WHUBFRROLIIXLC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|